4-bromothiophene-3-carbonitrile
Catalog No: FT-0710955
CAS No: 18895-10-8
- Chemical Name: 4-bromothiophene-3-carbonitrile
- Molecular Formula: C5H2BrNS
- Molecular Weight: 188.05
- InChI Key: RTOSSMAWCKNWFX-UHFFFAOYSA-N
- InChI: InChI=1S/C5H2BrNS/c6-5-3-8-2-4(5)1-7/h2-3H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 18895-10-8 |
|---|---|
| MF: | C5H2BrNS |
| Density: | 1.82g/cm3 |
| Flash_Point: | 128.7ºC |
| Melting_Point: | N/A |
| Product_Name: | 3-Bromo-4-cyanothiophene |
| Symbol: | GHS05, GHS07 |
| Bolling_Point: | 289.1ºC at 760mmHg |
| FW: | 188.04500 |
| Bolling_Point: | 289.1ºC at 760mmHg |
|---|---|
| Density: | 1.82g/cm3 |
| MF: | C5H2BrNS |
| LogP: | 2.38228 |
| Exact_Mass: | 186.90900 |
| Vapor_Pressure: | 0.00224mmHg at 25°C |
| Flash_Point: | 128.7ºC |
| FW: | 188.04500 |
| Refractive_Index: | 1.641 |
| PSA: | 52.03000 |
| Symbol: | GHS05, GHS07 |
|---|---|
| Safety_Statements: | H302-H315-H317-H318-H335 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)